SBI-477
Cat. No. :YN480804
CAS No. :781628-99-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | SBI-477 |
| CAS NO.: | 781628-99-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 483.54 |
| Molecular Formula: | C₂₄H₂₅N₃O₆S |
| SMILES: | O=C(NC1=NC(C2=CC=C(OC)C=C2)=CS1)C3=CC=C(OCC(N4CCOCC4)=O)C(OC)=C3 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | SBI-477 is a chemical probe stimulated insulin signaling by deactivating the transcription factorMondoA, leading to reduced expression of the insulin pathway suppressors thioredoxin-interacting protein (TXNIP) and arrestin domain–containing 4 (ARRDC4). SBI-477 coordinately inhibits triacylglyceride (TAG) synthesis and enhances basal glucose uptake in human skeletal myocytes. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
