Nomilin
Cat. No. :YN482483
CAS No. :1063-77-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Nomilin |
| CAS NO.: | 1063-77-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 514.56 |
| Molecular Formula: | C₂₈H₃₄O₉ |
| SMILES: | C[C@]([C@@](CC1)([H])[C@]2([C@H](CC3=O)OC(C)=O)C)(C(C[C@@]2([H])C(C)(O3)C)=O)[C@@]4([C@@H]5O4)[C@@]1([C@H](C6=COC=C6)OC5=O)C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Nomilin is a triterpenoid present in common edible citrus fruits with putative anticancer properties. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
