HSL-IN-1
Cat. No. :YN480129
CAS No. :2095156-13-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | HSL-IN-1 |
| CAS NO.: | 2095156-13-9 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 436.58 |
| Molecular Formula: | C₁₉H₁₃BClF₃N₂O₄ |
| SMILES: | O=C(NC1=C(B(O)O)C=C(Cl)C=C1)C(C=C2)=CN=C2OC3=CC=C(C(F)(F)F)C=C3 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | HSL-IN-1 (compound 24b) is a potent and orally activehormone sensitive lipase (HSL)inhibitor (IC50=2nM) with a significantly reduced reactive metabolite liability. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
