LG100754
Cat. No. :YN370416
CAS No. :180713-37-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | LG100754 |
| CAS NO.: | 180713-37-5 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 396.56 |
| Molecular Formula: | C₂₆H₃₆O₃ |
| SMILES: | C/C(C1=C(OCCC)C=C2C(C)(C)CCC(C)(C)C2=C1)=C/C=C/C(C)=C/C(O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | LG100754 (UVI 2112) is aRXR dimersmodulater. LG100754 acts as aRXR:RXRhomodimer antagonist, but functions as a agonist towardsRXR:PPARα and RXR:PPARγheterodimers. LG100754 is an insulin sensitizer that functions through RXR. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
