Minoxidil sulfate
Cat. No. :YN360866
CAS No. :83701-22-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Minoxidil sulfate |
| CAS NO.: | 83701-22-8 |
| Chemical Name: | |
| Synonyms: | U-58838 |
| Molecular Weight: | 289.31 |
| Molecular Formula: | C₉H₁₅N₅O₄S |
| SMILES: | NC1=NC(N2CCCCC2)=CC(N1OS(=O)(O)=O)=N |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Minoxidil is a potent direct-acting peripheral vasodilator that reduces peripheral resistance and produces a fall in blood pressure. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
