GPR120 modulator 2
Cat. No. :YN321277
CAS No. :1050506-87-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | GPR120 modulator 2 |
| CAS NO.: | 1050506-87-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 387.88 |
| Molecular Formula: | C₂₀H₁₈ClNO₃S |
| SMILES: | O=C(O)CCC1=CC=C(OCC2=NC(C3=CC=CC=C3Cl)=CS2)C=C1C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | GPR120 modulator 2 is aG protein coupled receptor 120 (GPR120)modulator extracted from patent US8394841B2, compound example F13. GPR120 modulator 2 can be used for the research of diseases associated with abnormal or deregulated GPR120, such as diabetes. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
