Kukoamine B
Cat. No. :YN482904
CAS No. :164991-67-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Kukoamine B |
| CAS NO.: | 164991-67-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 530.66 |
| Molecular Formula: | C₂₈H₄₂N₄O₆ |
| SMILES: | O=C(N(CCCN)CCCCNCCCNC(CCC1=CC=C(O)C(O)=C1)=O)CCC2=CC=C(O)C(O)=C2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Kukoamine B is a component of Lycii Cortex, with anti-oxidant, anti-acute inflammatory and anti-diabetic properties. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
