(+)-Magnoflorine iodide
Cat. No. :YN251471
CAS No. :4277-43-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | (+)-Magnoflorine iodide |
| CAS NO.: | 4277-43-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 469.31 |
| Molecular Formula: | C₂₀H₂₄INO₄ |
| SMILES: | C[N+]1(C)CCC2=CC(OC)=C(O)C3=C2[C@]1([H])CC4=CC=C(OC)C(O)=C34.[I-] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | (+)-Magnoflorine iodide (Magnoflorine iodide), an aporphine alkaloid found inAcoruscalamus, reduces the formation ofC. albicansbiofilm. (+)-Magnoflorine iodide has anti-fungal, anti-antidiabetic and anti-oxidative activity. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
