Alisol B
Cat. No. :YN482559
CAS No. :18649-93-9
Pack size
price
inventory
5mg
$ 500.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Alisol B |
| CAS NO.: | 18649-93-9 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 472.70 |
| Molecular Formula: | C₃₀H₄₈O₄ |
| SMILES: | C[C@]([C@@]1(C2=C([C@H](C)C[C@@H]([C@]3([H])C(C)(C)O3)O)CC1)C)(CC[C@@]4([H])C5(C)C)[C@]([C@H](C2)O)([H])[C@]4(CCC5=O)C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Alisol B can suppress C3a induced epithelial-mesenchymal transition . Alisol B may be a potential novel therapeutic molecule for bone disorders through targeting the differentiation of osteoclasts as well as their functions. Alisol B also inhibited RANKL-induced expression of NFATc1 and c-Fos, which are key transcription factors for osteoclastogenesis. The molecular target of Alisol B is the sarcoplasmic/endoplasmic reticulum Ca(2+) ATPase, it provides detailed insights into the cytotoxic mechanism of a novel antitumor compound. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
