DO34 analog
Cat. No. :YN480681
CAS No. :2098969-71-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | DO34 analog |
| CAS NO.: | 2098969-71-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 531.53 |
| Molecular Formula: | C₂₆H₂₈F₃N₅O₄ |
| SMILES: | O=C(N1C(CC2=CC=CC=C2)CN(C(OC(C)(C)C)=O)CC1)N3N=CC(C4=CC=C(OC(F)(F)F)C=C4)=N3 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | DO34 analog is a triazoleDAGL(α)inhibitor extracted from patent WO2017096315 A1, compound 100. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
