Senecionine
Cat. No. :YN482955
CAS No. :130-01-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Senecionine |
| CAS NO.: | 130-01-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 335.39 |
| Molecular Formula: | C₁₈H₂₅NO₅ |
| SMILES: | O=C1O[C@@]2([H])[C@]3([H])N(CC=C3COC([C@](C)(O)[C@H](C)C/C1=C/C)=O)CC2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Senecionine (Senecionan-11,16-dione, 12-hydroxy-) is a pyrrolizidine alkaloid isolated fromSenecio vulgaris. Senecionine is toxic to animals and humans. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
