Docosahexaenoic Acid
Cat. No. :YN372966
CAS No. :6217-54-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Docosahexaenoic Acid |
| CAS NO.: | 6217-54-5 |
| Chemical Name: | |
| Synonyms: | DHA, cervonic acid, doconexent |
| Molecular Weight: | 328.49 |
| Molecular Formula: | C₂₂H₃₂O₂ |
| SMILES: | CC/C=CC/C=CC/C=CC/C=CC/C=CC/C=CCCC(O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Docosahexaenoic Acid (DHA) is essential for the growth and functional development of the brain in infants. DHA is also required for maintenance of normal brain function in adults. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
