Heparan Sulfate
Cat. No. :YN370213
CAS No. :9050-30-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Heparan Sulfate |
| CAS NO.: | 9050-30-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 593.47 (monomer) |
| Molecular Formula: | C₁₂H₁₉NO₂₀S₃ (monomer) |
| SMILES: | O=S(OCC1O[C@@H](OC)[C@H](NS(=O)(O)=O)[C@@H](OS(=O)(O)=O)[C@H]1O[C@@H]2OC(C(O)=O)[C@H](O[C@@H]3OC(COS(=O)(O)=O)[C@H](O[C@@H]4OC(C(O)=O)[C@H](OC)[C@H](O)[C@H]4OS(=O)(O)=O)[C@H](O)[C@H]3NS(=O)(O)=O)[C@H](O)[C@H]2O)(O)=O.[n] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Heparan sulfate, a complex and linear polysaccharide, exists as part of glycoproteins named heparan sulfate proteoglycans, which are expressed abundantly on the cell surface and in the extracellular matrix. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
