6-Diazo-5-oxo-L-nor-Leucine
Cat. No. :YN250158
CAS No. :157-03-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 6-Diazo-5-oxo-L-nor-Leucine |
| CAS NO.: | 157-03-9 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 171.15 |
| Molecular Formula: | C₆H₉N₃O₃ |
| SMILES: | N[C@@H](CCC(C=[N+]=[N-])=O)C(O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | L-6-Diazo-5-oxonorleucine (L-6-Diazo-5-oxonorleucine) is aglutaminasesantagonist with a Ki of 6μM. L-6-Diazo-5-oxonorleucine exhibits analgesic, antibacterial, antiviral and anticancer properties. L-6-Diazo-5-oxonorleucine displays genetic toxicity in vitro. L-6-Diazo-5-oxonorleucine decreases the self-renewal potential and metastatic ability of tumor cell. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
