(R)-Baclofen
Cat. No. :YN360610
CAS No. :69308-37-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | (R)-Baclofen |
| CAS NO.: | 69308-37-8 |
| Chemical Name: | |
| Synonyms: | STX 209 |
| Molecular Weight: | 213.66 |
| Molecular Formula: | C₁₀H₁₂ClNO₂ |
| SMILES: | ClC1=CC=C([C@](CC(O)=O)([H])CN)C=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | (R)-baclofen is a derivative of gamma-aminobutyric acid primarily used to treat spasticity. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
