Liquiritigenin
Cat. No. :YN482434
CAS No. :578-86-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Liquiritigenin |
| CAS NO.: | 578-86-9 |
| Chemical Name: | |
| Synonyms: | 4',7-Dihydroxyflavanone |
| Molecular Weight: | 256.25 |
| Molecular Formula: | C₁₅H₁₂O₄ |
| SMILES: | O=C1C[C@@H](C2=CC=C(O)C=C2)OC3=CC(O)=CC=C13 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Liquiritigenin, the most active estrogenic compound from the root of Glycyrrhizae uralensis Fisch, selectively binds to ERβ with an IC50 value of 7.5 μM and activates multiple ER regulatory elements and native target genes with Erβ but not ERα. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
