SB 242084
Cat. No. :YN320732
CAS No. :181632-25-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | SB 242084 |
| CAS NO.: | 181632-25-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 394.85 |
| Molecular Formula: | C₂₁H₁₉ClN₄O₂ |
| SMILES: | O=C(N1CCC2=C1C=C(Cl)C(C)=C2)NC3=CC=C(OC4=CC=CN=C4C)N=C3 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | SB 242084 is a 5-HT2C receptor antagonist(pKi=9.0) that displays 158- and 100-fold selectivity over 5-HT2A and 5-HT2B receptors respectively. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
