Citicoline sodium
Cat. No. :YN372848
CAS No. :33818-15-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Citicoline sodium |
| CAS NO.: | 33818-15-4 |
| Chemical Name: | |
| Synonyms: | CDP-choline |
| Molecular Weight: | 510.31 |
| Molecular Formula: | C₁₄H₂₅N₄NaO₁₁P₂ |
| SMILES: | O[C@H]1[C@H](N(C=CC(N)=N2)C2=O)O[C@H](COP(OP(OCC[N+](C)(C)C)([O-])=O)(O[Na])=O)[C@H]1O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Citicoline is an essential intermediate in the synthesis of the major phospholipid of the cell membranes, phosphatidylcholine (PtdCho). It increases plasma adrenocorticotropic hormone (ACTH) levels and potentiates serum thyrotrophin (TSH) levels by activating the central cholinergic system. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
