Edrophonium chloride
Cat. No. :YN380187
CAS No. :116-38-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Edrophonium chloride |
| CAS NO.: | 116-38-1 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 201.69 |
| Molecular Formula: | C₁₀H₁₆ClNO |
| SMILES: | C[N+](C)(CC)C1=CC=CC(O)=C1.[Cl-] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Edrophonium chloride is the chloride salt of edrophonium, which is a rapid-onset, short-acting, readily reversible inhibitor of acetylcholinesterase. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
