Onjisaponin B
Cat. No. :YN280147
CAS No. :35906-36-6
Pack size
price
inventory
10mg
$ 457.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Onjisaponin B |
| CAS NO.: | 35906-36-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 1573.67 |
| Molecular Formula: | C₇₅H₁₁₂O₃₅ |
| SMILES: | OC[C@](C1=CC[C@]2([H])[C@]3(C[C@H](O)[C@@H]4O[C@]([C@@H]([C@@H](O)[C@@H]5O)O)([H])O[C@@H]5CO)C)(CC[C@]6(C(O[C@H](O[C@H](C)[C@H](OC(/C=C/C7=CC=C(OC)C=C7)=O)[C@@H]8O[C@@](O[C@@H](C)[C@H](O)[C@H]9O)([H])[C@@H]9O)[C@@H]8O[C@@](O[C@@H](C)[C@H](O[C@@](OC[C@@H](O[C@]([C@@H]([C@@H](O)[C@H]%10O)O)([H])O[C@@H]%10CO)[C@@H]%11O)([H])[C@@H]%11O)[C@H]%12O)([H])[C@@H]%12O)=O)[C@@]1([H])CC(C)(C)CC6)[C@@]2(CC[C@@]3([H])[C@]4(C)C(O)=O)C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Onjisaponin B is a natural product derived fromRadix Polygalae. Onjisaponin B enhances autophagy and accelerates the degradation of mutant α-synuclein and huntingtin in PC-12 cells, and exbibits potential therapeutic effects on Parkinson disease and Huntington disease. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
