VU0810464
Cat. No. :YN360370
CAS No. :2126040-21-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | VU0810464 |
| CAS NO.: | 2126040-21-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 349.83 |
| Molecular Formula: | C₁₈H₂₁ClFN₃O |
| SMILES: | O=C(NC1=CC(C)=NN1C2CCCCC2)CC3=CC=C(F)C(Cl)=C3 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | VU0810464 is a potent and selective non-ureaG protein-gated inwardly-rectifying potassium channels (GIRK, Kir3) activator. VU0810464 displays nanomolar potency for neuronal (EC50=165nM) and GIRK1/4 (EC50=720nM) channels with improved brain penetration. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
