Xanthocillin X permethyl ether
Cat. No. :YN480488
CAS No. :4464-33-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Xanthocillin X permethyl ether |
| CAS NO.: | 4464-33-9 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 316.35 |
| Molecular Formula: | C₂₀H₁₆N₂O₂ |
| SMILES: | [C-]#[N+]C(/C([N+]#[C-])=C/C1=CC=C(OC)C=C1)=CC2=CC=C(OC)C=C2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Xanthocillin X permethyl ether is a natural compound isolated from fungal extracts, with Aβ-42 lowering activity. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
