Dencichine
Cat. No. :YN373214
CAS No. :5302-45-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Dencichine |
| CAS NO.: | 5302-45-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 176.13 |
| Molecular Formula: | C₅H₈N₂O₅ |
| SMILES: | N[C@@H](CNC(C(O)=O)=O)C(O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Dencichin is a non-protein amino acid originally extracted fromPanax notoginseng, and can inhibitHIF-prolyl hydroxylase-2 (PHD-2)activity. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
