Metaxalone
Cat. No. :YN481848
CAS No. :1665-48-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Metaxalone |
| CAS NO.: | 1665-48-1 |
| Chemical Name: | |
| Synonyms: | Skelaxin, Methaxalonum, Zorane |
| Molecular Weight: | 221.25 |
| Molecular Formula: | C₁₂H₁₅NO₃ |
| SMILES: | O=C1OC(COC2=CC(C)=CC(C)=C2)CN1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Metaxalone is a muscle relaxant used to relax muscles and relieve pain caused by strains, sprains, and other musculoskeletal conditions. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
