QX-314 chloride
Cat. No. :YN360210
CAS No. :5369-03-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | QX-314 chloride |
| CAS NO.: | 5369-03-9 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 298.85 |
| Molecular Formula: | C₁₆H₂₇ClN₂O |
| SMILES: | O=C(NC1=C(C)C=CC=C1C)C[N+](CC)(CC)CC.[Cl-] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | QX-314 chloride directly activates and permeates the human isoforms of TRPV1 and TRPA1 to induce inhibition of sodium channels. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
