Tetrahydroberberine
Cat. No. :YN1730113
CAS No. :522-97-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Tetrahydroberberine |
| CAS NO.: | 522-97-4 |
| Chemical Name: | |
| Synonyms: | Canadine |
| Molecular Weight: | 339.39 |
| Molecular Formula: | C₂₀H₂₁NO₄ |
| SMILES: | COC1=CC=C(CC23)C(CN2CCC(C3=C4)=CC5=C4OCO5)=C1OC |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Tetrahydroberberine is an isoquinoline alkaloid with micromolar affinity for dopamine D2 (antagonist, pKi = 6.08) and 5-HT1A (agonist, pKi = 5.38) receptors but moderate to no affinity for other relevant serotonin receptors. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
