Rosiridin
Cat. No. :YN380229
CAS No. :100462-37-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Rosiridin |
| CAS NO.: | 100462-37-1 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 332.39 |
| Molecular Formula: | C₁₆H₂₈O₇ |
| SMILES: | O[C@H]([C@@H](O)[C@@H]1O)[C@@H](O[C@@H]1CO)OC/C=C(C)/[C@@H](O)C/C=C(C)/C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Rosiridin, which is isolated fromRhodiola roseaL., inhibitsMAO A and MAO Bwith potential beneficial effect in depression and senile dementia. Rosiridin shows an inhibition of 83.8% against MAO B at 10μM (pIC50=5.38). |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
