Shanzhiside methyl ester
Cat. No. :YN1730112
CAS No. :64421-28-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Shanzhiside methyl ester |
| CAS NO.: | 64421-28-9 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 406.38 |
| Molecular Formula: | C₁₇H₂₆O₁₁ |
| SMILES: | O[C@H]([C@@H](O)[C@@H]1O)[C@](O[C@@H]1CO)([H])O[C@H]2[C@@]([C@]3(O)C)([H])[C@@]([C@H](O)C3)([H])C(C(OC)=O)=CO2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Shanzhiside methy lester is isolated fromL. rotata. Shanzhiside methyl ester is a small moleculeglucagon-like peptide-1 (GLP-1) receptoragonist and has the ability to induce anti-allodynic tolerance. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
