Metoprine
Cat. No. :YN290230
CAS No. :7761-45-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Metoprine |
| CAS NO.: | 7761-45-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 269.13 |
| Molecular Formula: | C₁₁H₁₀Cl₂N₄ |
| SMILES: | CC1=C(C(N)=NC(N)=N1)C2=CC=C(C(Cl)=C2)Cl |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Metoprine (BW 197U) is a potenthistamine N-methyltransferase (HMT)inhibitor. Metoprine, a diaminopyrimidine derivative, can cross the blood-brain barrier and increase brain histamine levels by inhibiting HMT. Metoprine is anantifolate and antitumor agent. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
