Ciwujianoside B
Cat. No. :YN270458
CAS No. :114902-16-8
Pack size
price
inventory
10mg
$ 571.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Ciwujianoside B |
| CAS NO.: | 114902-16-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 1189.34 |
| Molecular Formula: | C₅₈H₉₂O₂₅ |
| SMILES: | O[C@@H]1[C@H](O)[C@@H](O[C@@]2([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O2)[C@]([H])(O[C@@H]3C(C)(C)[C@@](CC[C@]4(C)[C@@]5(CC=C6[C@]4(CC[C@](CC7)(C(O[C@@H]8O[C@H](CO[C@H]9[C@H](O)[C@@H](O)[C@H](O[C@@]%10([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O%10)[C@@H](CO)O9)[C@@H](O)[C@H](O)[C@H]8O)=O)[C@@]6([H])CC7=C)C)[H])([H])[C@]5(C)CC3)OC1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Ciwujianoside B is isolated fromEleutherococcus senticosusleaf, is able to penetrate and work in the brain after the oral administration. Ciwujianoside B significantly enhances object recognition memory. Ciwujianoside B shows radioprotective effects on the hematopoietic system in mice, which is associated with changes in the cell cycle, reduces DNA damage and down-regulates the ratio ofBax/Bcl-2in bone marrow cells exposed to radiation. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
