HAMI 3379
Cat. No. :YN320451
CAS No. :712313-35-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | HAMI 3379 |
| CAS NO.: | 712313-35-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 595.72 |
| Molecular Formula: | C₃₄H₄₅NO₈ |
| SMILES: | O=C(O)C1=CC=C(OCCCC2=CC=C(OCCCCOC3CCCCC3)C=C2)C(C(NC4CC(C(O)=O)CCC4)=O)=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | HAMI 3379 is a potent and selectiveCysteinyl leukotriene (CysLT2) receptorantagonist. HAMI 3379 has a protective effect on acute and subacute ischemic brain injury, and attenuates microglia-related inflammation. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
