Pomaglumetad methionil anhydrous
Cat. No. :YN320887
CAS No. :635318-55-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Pomaglumetad methionil anhydrous |
| CAS NO.: | 635318-55-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 366.41 |
| Molecular Formula: | C₁₂H₁₈N₂O₇S₂ |
| SMILES: | O=C([C@]1(NC([C@@H](N)CCSC)=O)CS([C@@]2([H])[C@H](C(O)=O)[C@@]12[H])(=O)=O)O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Pomaglumetad methionil anhydrous (LY2140023) is an orally active, methionine prodrug of the selective mGlu2/3 receptor agonist LY404039. LY2140023 has the potential for schizophrenia research. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
