Incensole
Cat. No. :YN483091
CAS No. :22419-74-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Incensole |
| CAS NO.: | 22419-74-5 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 306.48 |
| Molecular Formula: | C₂₀H₃₄O₂ |
| SMILES: | O[C@@H]1[C@@](O2)(C)CC[C@@]2(C(C)C)C/C=C(C)/CC/C=C(C)/CC1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
