Timosaponin B III
Cat. No. :YN483370
CAS No. :142759-74-8
Pack size
price
inventory
10mg
$ 457.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Timosaponin B III |
| CAS NO.: | 142759-74-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 903.06 |
| Molecular Formula: | C₄₅H₇₄O₁₈ |
| SMILES: | C[C@@]12[C@](C[C@@]3([H])[C@]2([H])C(C)=C(CC[C@H](C)CO[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO)O3)([H])[C@@]5([H])[C@]([C@@]6([C@](C[C@@H](O[C@@]7([H])[C@@H]([C@H]([C@@H](O)[C@@H](CO)O7)O)O[C@]8([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]8O)CO)CC6)([H])CC5)C)([H])CC1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Timosaponin B III is a major bioactive steroidal saponin isolated fromAnemarrhena asphodeloidesBge, and exhibits anti-inflammatory, anti-platelet aggregative and anti-depressive effects . |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
