Jujuboside B
Cat. No. :YN482517
CAS No. :55466-05-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Jujuboside B |
| CAS NO.: | 55466-05-2 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 1045.21 |
| Molecular Formula: | C₅₂H₈₄O₂₁ |
| SMILES: | C[C@]([C@]1([H])CC2)(CC[C@]3([H])[C@@]1(CC[C@H](O[C@@](OC[C@H](O)[C@@H]4O[C@@](O[C@H](CO)[C@@H](O)[C@@H]5O)([H])[C@@H]5O[C@@](OC[C@@H](O)[C@@H]6O)([H])[C@@H]6O)([H])[C@@H]4O[C@@](O[C@@H](C)[C@H](O)[C@H]7O)([H])[C@@H]7O)C3(C)C)C)[C@@]8(CO9)[C@@]2([H])[C@]([C@]%10(O)C)([H])[C@@]9(O[C@@H](/C=C(C)/C)C%10)C8 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Jujuboside B is one of the major bioactive constituents isolated fromZizyphus jujuba. Jujuboside B can inhibit platelet aggregation. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
