FW1256
Cat. No. :YN410028
CAS No. :117089-08-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | FW1256 |
| CAS NO.: | 117089-08-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 247.25 |
| Molecular Formula: | C₁₂H₁₀NOPS |
| SMILES: | S=P1(OC2=CC=CC=C2N1)C3=CC=CC=C3 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | FW1256 is a phenyl analogue and a slow-releasing hydrogen sulfide (H2S) donor. FW1256 inhibitsNF-κBactivity and induces cellapoptosis. FW1256 exerts potent anti-inflammatory effects and has the potential for cancer and cardiovascular disease treatment. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
