Salvianolic acid B
Cat. No. :YN280146
CAS No. :121521-90-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Salvianolic acid B |
| CAS NO.: | 121521-90-2 |
| Chemical Name: | |
| Synonyms: | Lithospermate B |
| Molecular Weight: | 718.61 |
| Molecular Formula: | C₃₆H₃₀O₁₆ |
| SMILES: | O=C([C@@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=C(O)C=CC(/C=C/C(O[C@@H](C(O)=O)CC4=CC=C(O)C(O)=C4)=O)=C13)O[C@@H](C(O)=O)CC5=CC=C(O)C(O)=C5 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Salvianolic acid B (Sal B), an antioxidant and free radical scavenging compound, is the most abundant bioactive compound extracted from the root of Salvia miltiorrhiza Bunge. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
