Asiaticoside
Cat. No. :YN330550
CAS No. :16830-15-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Asiaticoside |
| CAS NO.: | 16830-15-2 |
| Chemical Name: | |
| Synonyms: | Ba 2742, BRN0078195, CCRIS8995, NSC166062, Emdecassol,Madecassol |
| Molecular Weight: | 959.12 |
| Molecular Formula: | C₄₈H₇₈O₁₉ |
| SMILES: | C[C@@H]1CC[C@@]2(C(O[C@@H]3O[C@H](CO[C@H]4[C@H](O)[C@@H](O)[C@H](O[C@@]5([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](CO)O4)[C@@H](O)[C@H](O)[C@H]3O)=O)[C@@](C6=CC[C@@]([C@](C[C@@H](O)[C@H](O)[C@]7(CO)C)(C)[C@@]7([H])CC8)([H])[C@]8(C)[C@]6(C)CC2)([H])[C@H]1C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Asiaticoside, the major active principle of Centella asiatica, prevents ultraviolet A-dependent photoaging by suppressing ultraviolet A-induced reactive oxygen species production. It also decreases DNA binding by MITF. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
