Milrinone
Cat. No. :YN372186
CAS No. :78415-72-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Milrinone |
| CAS NO.: | 78415-72-2 |
| Chemical Name: | |
| Synonyms: | Win 47203 |
| Molecular Weight: | 211.22 |
| Molecular Formula: | C₁₂H₉N₃O |
| SMILES: | CC(N1)=C(C2=CC=NC=C2)C=C(C#N)C1=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Milrinone is a phosphodiesterase 3 (PDE3) inhibitor, used to increase the heart's contractility. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
