SB-633825
Cat. No. :YN480382
CAS No. :956613-01-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | SB-633825 |
| CAS NO.: | 956613-01-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 483.58 |
| Molecular Formula: | C₂₈H₂₅N₃O₃S |
| SMILES: | O=S(C1=CC=C(C2=NC(C3=CC=NC=C3)=C(C4=CC=C5C=C(OC)C=CC5=C4)N2C)C(C)=C1)(C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | SB-633825 is a potent and ATP-competitive inhibitor ofTIE2,LOK (STK10) and BRKwith IC50s of 3.5nM, 66nM, 150nM, respectively. SB-633825 can inhibit cancer cell growth and angiogenesis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
