Metolazone
Cat. No. :YN372759
CAS No. :17560-51-9
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Metolazone |
| CAS NO.: | 17560-51-9 |
| Chemical Name: | |
| Synonyms: | SR 720-22 |
| Molecular Weight: | 365.83 |
| Molecular Formula: | C₁₆H₁₆ClN₃O₃S |
| SMILES: | O=S(C1=CC2=C(NC(C)N(C3=CC=CC=C3C)C2=O)C=C1Cl)(N)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Metolazone is a diuretic that primarily used to treat congestive heart failure and high blood pressure. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
