Mexiletine hydrochloride
Cat. No. :YN360721
CAS No. :5370-01-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Mexiletine hydrochloride |
| CAS NO.: | 5370-01-4 |
| Chemical Name: | |
| Synonyms: | KO1173 |
| Molecular Weight: | 215.72 |
| Molecular Formula: | C₁₁H₁₈ClNO |
| SMILES: | CC(N)COC1=C(C)C=CC=C1C.[H]Cl |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Mexiletine HCl belongs to Class IB anti-arrhythmic group of medicines, inhibits sodium channels to reduce the inward sodium current. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
