Avosentan
Cat. No. :YN320947
CAS No. :290815-26-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Avosentan |
| CAS NO.: | 290815-26-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 479.51 |
| Molecular Formula: | C₂₃H₂₁N₅O₅S |
| SMILES: | COC1=C(OC(C(NS(C2=NC=C(C=C2)C)(=O)=O)=NC(C3=CC=NC=C3)=N4)=C4OC)C=CC=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Avosentan(Ro 67-0565; SPP-301) is a potent, selective endothelin receptor(ETA receptor) antagonist. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
