Aspartic acid calcium
Cat. No. :YN482519
CAS No. :10389-09-0
Pack size
price
inventory
500mg
$ 50.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Aspartic acid calcium |
| CAS NO.: | 10389-09-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 171.16 |
| Molecular Formula: | C₄H₅CaNO₄ |
| SMILES: | N[C@@H](CC([O-])=O)C([O-])=O.[Ca+2] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Aspartic acid calcium (Calcium L-aspartate) is a chelate where calcium is attached to an amino acid naming L-Aspartic acid. L-Aspartic acid is an amino acid and serves as a building block for proteins in the body. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
