Cy5.5
Cat. No. :YN482272
CAS No. :210892-23-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Cy5.5 |
| CAS NO.: | 210892-23-2 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 917.05 |
| Molecular Formula: | C₄₁H₄₄N₂O₁₄S₄ |
| SMILES: | O=S(C1=CC(S(=O)([O-])=O)=C2C(C3=C([N+](CC)=C(/C=C/C=C/C=C4N(CCCCCC(O)=O)C5=C(C6=CC(S(=O)(O)=O)=CC(S(=O)(O)=O)=C6C=C5)C/4(C)C)C3(C)C)C=C2)=C1)(O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Cy5.5 (Sulfo-Cyanine5.5) is a near-infrared fluorescent dye (Ex=673nM, Em=707nM) used to label biological molecules, such as peptides, proteins, and oligonucleotides. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
