Bepridil hydrochloride hydrate
Cat. No. :YN360598
CAS No. :74764-40-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Bepridil hydrochloride hydrate |
| CAS NO.: | 74764-40-2 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 421.02 |
| Molecular Formula: | C₂₄H₃₇ClN₂O₂ |
| SMILES: | CC(C)COCC(N1CCCC1)CN(C2=CC=CC=C2)CC3=CC=CC=C3.[H]Cl.[H]O[H] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Bepridil hydrochloride is an anti-anginal drug classified as a calcium channel blocker. It also blocks multiple other ion channels, including sodium and potassium channels. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
