TIE-2/VEGFR-2 kinase-IN-1
Cat. No. :YN440153
CAS No. :453590-24-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | TIE-2/VEGFR-2 kinase-IN-1 |
| CAS NO.: | 453590-24-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 241.25 |
| Molecular Formula: | C₁₃H₁₁N₃O₂ |
| SMILES: | NC1=C2C(OC(C3=CC=C(OC)C=C3)=C2)=NC=N1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | TIE-2/VEGFR-2 kinase-IN-1 is used for the synthesis of TIE-2 and /or VEGFR-2 inhibitors, extracted from patent WO2003022852, example 14. TIE-2/VEGFR-2 kinase-IN-1 is used for the study of diseases associated with inappropriate angiogenesis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
