Etoricoxib
Cat. No. :YN330307
CAS No. :202409-33-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Etoricoxib |
| CAS NO.: | 202409-33-4 |
| Chemical Name: | |
| Synonyms: | Arcoxia, MK-663, MK-0663, Tauxib, Algix, Nucoxia |
| Molecular Weight: | 358.84 |
| Molecular Formula: | C₁₈H₁₅ClN₂O₂S |
| SMILES: | O=S(C1=CC=C(C2=CC(Cl)=CN=C2C3=CC=C(C)N=C3)C=C1)(C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Etoricoxib is a new COX-2 selective inhibitor with anti-inflammatory, antipyretic, analgesic, and potential antineoplastic properties. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
