Prim-O-glucosylcimifugin
Cat. No. :YN330572
CAS No. :80681-45-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Prim-O-glucosylcimifugin |
| CAS NO.: | 80681-45-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 468.45 |
| Molecular Formula: | C₂₂H₂₈O₁₁ |
| SMILES: | COC1=C(C[C@@H](C(C)(O)C)O2)C2=CC(OC(CO[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO)=C4)=C1C4=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Prim-O-glucosylcimifugin exerts anti-inflammatory effects through the inhibition ofiNOS and COX-2expression by through regulating JAK2/STAT3 signaling. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
