Oxaprozin
Cat. No. :YN330459
CAS No. :21256-18-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Oxaprozin |
| CAS NO.: | 21256-18-8 |
| Chemical Name: | |
| Synonyms: | WY-21743 |
| Molecular Weight: | 293.32 |
| Molecular Formula: | C₁₈H₁₅NO₃ |
| SMILES: | O=C(O)CCC1=NC(C2=CC=CC=C2)=C(C3=CC=CC=C3)O1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Oxaprozin is a non-narcotic, non-steroidal anti-inflammatory drug (NSAID) used to relieve the inflammation, swelling, stiffness, and joint pain associated with osteoarthritis and rheumatoid arthritis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.